Product Information:
| Cat. No.: EX-A13461X | Purity: >98% |
![]() | |
| Chemical structure of tert-butyl (4,4-dimethylpiperidin-3-yl)carbamate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1500902-80-6 |
|---|---|
| Purity | >98% |
| Formula | C12H24N2O2 |
| Mol Weight | 228.3312 |
| CoA | CoA of tert-butyl (4,4-dimethylpiperidin-3-yl)carbamate |
| Smiles: | O=C(OC(C)(C)C)NC1CNCCC1(C)C |
|---|
KEYWORDS: buy tert-butyl (4,4-dimethylpiperidin-3-yl)carbamate | tert-butyl (4,4-dimethylpiperidin-3-yl)carbamate supplier | purchase | cost | manufacturer | order | distributor | buy 1500902-80-6 | 1500902-80-6 supplier


Inhibitor Specialist
